C18H12BrN3O3S — CID 126045222
N-(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(3-nitrophenyl)methanimine (PubChem CID 126045222) has the molecular formula C18H12BrN3O3S and a molecular weight of 430.28 g/mol. Its IUPAC name is N-(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(3-nitrophenyl)methanimine.
| Compound Name | N-(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(3-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 126045222 |
| Molecular Formula | C18H12BrN3O3S |
| Molecular Weight | 430.28 g/mol |
| Exact Mass | 428.98 |
| IUPAC Name | N-(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(3-nitrophenyl)methanimine |
| SMILES | COc1ccc(Br)c2c1-c1nc(N=Cc3cccc([N+](=O)[O-])c3)sc1C2 |
| InChI | InChI=1S/C18H12BrN3O3S/c1-25-14-6-5-13(19)12-8-15-17(16(12)14)21-18(26-15)20-9-10-3-2-4-11(7-10)22(23)24/h2-7,9H,8H2,1H3 |
| InChIKey | BERJOHOVAULBHE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 77.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.28 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|