C19H15BrN2O2S — CID 46741674
(E)-1-(3-bromo-4-methoxyphenyl)-N-(6-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)methanimine (PubChem CID 46741674) has the molecular formula C19H15BrN2O2S and a molecular weight of 415.31 g/mol. Its IUPAC name is (E)-1-(3-bromo-4-methoxyphenyl)-N-(6-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)methanimine.
| Compound Name | (E)-1-(3-bromo-4-methoxyphenyl)-N-(6-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)methanimine |
|---|---|
| PubChem CID | 46741674 |
| Molecular Formula | C19H15BrN2O2S |
| Molecular Weight | 415.31 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | (E)-1-(3-bromo-4-methoxyphenyl)-N-(6-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)methanimine |
| SMILES | COc1ccc2c(c1)Cc1sc(/N=C/c3ccc(OC)c(Br)c3)nc1-2 |
| InChI | InChI=1S/C19H15BrN2O2S/c1-23-13-4-5-14-12(8-13)9-17-18(14)22-19(25-17)21-10-11-3-6-16(24-2)15(20)7-11/h3-8,10H,9H2,1-2H3/b21-10+ |
| InChIKey | KQQZKXOWUHXDDW-UFFVCSGVSA-N |
| XLogP | 5.24 |
| TPSA | 43.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.31 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|