C18H14N2OS — CID 126053450
N-(6-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-phenylmethanimine (PubChem CID 126053450) has the molecular formula C18H14N2OS and a molecular weight of 306.39 g/mol. Its IUPAC name is N-(6-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-phenylmethanimine.
| Compound Name | N-(6-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-phenylmethanimine |
|---|---|
| PubChem CID | 126053450 |
| Molecular Formula | C18H14N2OS |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | N-(6-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-phenylmethanimine |
| SMILES | COc1ccc2c(c1)Cc1sc(N=Cc3ccccc3)nc1-2 |
| InChI | InChI=1S/C18H14N2OS/c1-21-14-7-8-15-13(9-14)10-16-17(15)20-18(22-16)19-11-12-5-3-2-4-6-12/h2-9,11H,10H2,1H3 |
| InChIKey | MDALDSRQABJBGA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|