C20H17ClN2O2S — CID 23904578
1-(4-chloro-3-methoxyphenyl)-N-(7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)methanimine (PubChem CID 23904578) has the molecular formula C20H17ClN2O2S and a molecular weight of 384.89 g/mol. Its IUPAC name is 1-(4-chloro-3-methoxyphenyl)-N-(7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)methanimine.
| Compound Name | 1-(4-chloro-3-methoxyphenyl)-N-(7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)methanimine |
|---|---|
| PubChem CID | 23904578 |
| Molecular Formula | C20H17ClN2O2S |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 1-(4-chloro-3-methoxyphenyl)-N-(7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)methanimine |
| SMILES | COc1ccc2c(c1)CCc1sc(N=Cc3ccc(Cl)c(OC)c3)nc1-2 |
| InChI | InChI=1S/C20H17ClN2O2S/c1-24-14-5-6-15-13(10-14)4-8-18-19(15)23-20(26-18)22-11-12-3-7-16(21)17(9-12)25-2/h3,5-7,9-11H,4,8H2,1-2H3 |
| InChIKey | JWCYUTKBMHTOIG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 43.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|