C12H11N3O2S — CID 71595813
N-hydroxy-N'-(6-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)methanimidamide (PubChem CID 71595813) has the molecular formula C12H11N3O2S and a molecular weight of 261.31 g/mol. Its IUPAC name is N-hydroxy-N'-(6-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)methanimidamide.
| Compound Name | N-hydroxy-N'-(6-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)methanimidamide |
|---|---|
| PubChem CID | 71595813 |
| Molecular Formula | C12H11N3O2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | N-hydroxy-N'-(6-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)methanimidamide |
| SMILES | COc1ccc2c(c1)Cc1sc(/N=C\NO)nc1-2 |
| InChI | InChI=1S/C12H11N3O2S/c1-17-8-2-3-9-7(4-8)5-10-11(9)15-12(18-10)13-6-14-16/h2-4,6,16H,5H2,1H3,(H,13,14,15) |
| InChIKey | UIYCKDWZKDNFHG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|