C18H14N2O2S — CID 137170332
4-[(6-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)iminomethyl]phenol (PubChem CID 137170332) has the molecular formula C18H14N2O2S and a molecular weight of 322.39 g/mol. Its IUPAC name is 4-[(6-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)iminomethyl]phenol.
| Compound Name | 4-[(6-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 137170332 |
| Molecular Formula | C18H14N2O2S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 4-[(6-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)iminomethyl]phenol |
| SMILES | COc1ccc2c(c1)Cc1sc(N=Cc3ccc(O)cc3)nc1-2 |
| InChI | InChI=1S/C18H14N2O2S/c1-22-14-6-7-15-12(8-14)9-16-17(15)20-18(23-16)19-10-11-2-4-13(21)5-3-11/h2-8,10,21H,9H2,1H3 |
| InChIKey | ONDKFOXDDGVTQS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|