C19H16N2O2S — CID 135670479
4-[(7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]phenol (PubChem CID 135670479) has the molecular formula C19H16N2O2S and a molecular weight of 336.42 g/mol. Its IUPAC name is 4-[(7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]phenol.
| Compound Name | 4-[(7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 135670479 |
| Molecular Formula | C19H16N2O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 4-[(7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]phenol |
| SMILES | COc1ccc2c(c1)CCc1sc(N=Cc3ccc(O)cc3)nc1-2 |
| InChI | InChI=1S/C19H16N2O2S/c1-23-15-7-8-16-13(10-15)4-9-17-18(16)21-19(24-17)20-11-12-2-5-14(22)6-3-12/h2-3,5-8,10-11,22H,4,9H2,1H3 |
| InChIKey | FATJSKNVDCSJLH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|