About 2-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]phenol
2-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]phenol (PubChem CID 754846) has the molecular formula C19H16N2O2S
and a molecular weight of 336.42 g/mol. Its IUPAC name is 2-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]phenol.
Molecular Properties
| Compound Name | 2-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]phenol |
| PubChem CID | 754846 |
| Molecular Formula | C19H16N2O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]phenol |
| SMILES | COc1ccc2c(c1)-c1nc(N=Cc3ccccc3O)sc1CC2 |
| InChI | InChI=1S/C19H16N2O2S/c1-23-14-8-6-12-7-9-17-18(15(12)10-14)21-19(24-17)20-11-13-4-2-3-5-16(13)22/h2-6,8,10-11,22H,7,9H2,1H3 |
| InChIKey | IKIQEDZACVLUJI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]phenol?
The IUPAC name of 2-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]phenol (CID 754846) is 2-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]phenol.
What is the SMILES notation for 2-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]phenol?
The canonical SMILES for 2-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]phenol is COc1ccc2c(c1)-c1nc(N=Cc3ccccc3O)sc1CC2.
What is the InChIKey of 2-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]phenol?
The InChIKey is IKIQEDZACVLUJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O2S/c1-23-14-8-6-12-7-9-17-18(15(12)10-14)21-19(24-17)20-11-13-4-2-3-5-16(13)22/h2-6,8,10-11,22H,7,9H2,1H3.
What are the key properties of 2-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]phenol?
2-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]phenol has a molecular weight of 336.42 g/mol, XLogP of 4.37, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(8-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]phenol is sourced from PubChem (CID 754846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).