C20H18N2O3S — CID 135578290
2-methoxy-6-[(E)-(7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]phenol (PubChem CID 135578290) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is 2-methoxy-6-[(E)-(7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]phenol.
| Compound Name | 2-methoxy-6-[(E)-(7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]phenol |
|---|---|
| PubChem CID | 135578290 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 2-methoxy-6-[(E)-(7-methoxy-4,5-dihydrobenzo[e][1,3]benzothiazol-2-yl)iminomethyl]phenol |
| SMILES | COc1ccc2c(c1)CCc1sc(/N=C/c3cccc(OC)c3O)nc1-2 |
| InChI | InChI=1S/C20H18N2O3S/c1-24-14-7-8-15-12(10-14)6-9-17-18(15)22-20(26-17)21-11-13-4-3-5-16(25-2)19(13)23/h3-5,7-8,10-11,23H,6,9H2,1-2H3/b21-11+ |
| InChIKey | KBWFORUCHXMMKH-SRZZPIQSSA-N |
| XLogP | 4.38 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|