C19H16N2O2S — CID 126050200
N-(6-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(4-methoxyphenyl)methanimine (PubChem CID 126050200) has the molecular formula C19H16N2O2S and a molecular weight of 336.42 g/mol. Its IUPAC name is N-(6-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(4-methoxyphenyl)methanimine.
| Compound Name | N-(6-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(4-methoxyphenyl)methanimine |
|---|---|
| PubChem CID | 126050200 |
| Molecular Formula | C19H16N2O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | N-(6-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(4-methoxyphenyl)methanimine |
| SMILES | COc1ccc(C=Nc2nc3c(s2)Cc2cc(OC)ccc2-3)cc1 |
| InChI | InChI=1S/C19H16N2O2S/c1-22-14-5-3-12(4-6-14)11-20-19-21-18-16-8-7-15(23-2)9-13(16)10-17(18)24-19/h3-9,11H,10H2,1-2H3 |
| InChIKey | ANOAFFJPWOJKIO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 43.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|