C20H15BrN2O3S — CID 126056150
methyl 4-[(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)iminomethyl]benzoate (PubChem CID 126056150) has the molecular formula C20H15BrN2O3S and a molecular weight of 443.32 g/mol. Its IUPAC name is methyl 4-[(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)iminomethyl]benzoate.
| Compound Name | methyl 4-[(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)iminomethyl]benzoate |
|---|---|
| PubChem CID | 126056150 |
| Molecular Formula | C20H15BrN2O3S |
| Molecular Weight | 443.32 g/mol |
| Exact Mass | 442.00 |
| IUPAC Name | methyl 4-[(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)iminomethyl]benzoate |
| SMILES | COC(=O)c1ccc(C=Nc2nc3c(s2)Cc2c(Br)ccc(OC)c2-3)cc1 |
| InChI | InChI=1S/C20H15BrN2O3S/c1-25-15-8-7-14(21)13-9-16-18(17(13)15)23-20(27-16)22-10-11-3-5-12(6-4-11)19(24)26-2/h3-8,10H,9H2,1-2H3 |
| InChIKey | YCYMXMHFFLHVLR-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 60.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.32 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|