C18H12BrClN2OS — CID 4122585
N-(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(3-chlorophenyl)methanimine (PubChem CID 4122585) has the molecular formula C18H12BrClN2OS and a molecular weight of 419.73 g/mol. Its IUPAC name is N-(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(3-chlorophenyl)methanimine.
| Compound Name | N-(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(3-chlorophenyl)methanimine |
|---|---|
| PubChem CID | 4122585 |
| Molecular Formula | C18H12BrClN2OS |
| Molecular Weight | 419.73 g/mol |
| Exact Mass | 417.95 |
| IUPAC Name | N-(5-bromo-8-methoxy-4H-indeno[1,2-d][1,3]thiazol-2-yl)-1-(3-chlorophenyl)methanimine |
| SMILES | COc1ccc(Br)c2c1-c1nc(N=Cc3cccc(Cl)c3)sc1C2 |
| InChI | InChI=1S/C18H12BrClN2OS/c1-23-14-6-5-13(19)12-8-15-17(16(12)14)22-18(24-15)21-9-10-3-2-4-11(20)7-10/h2-7,9H,8H2,1H3 |
| InChIKey | ROROQIQMKHMMGC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.73 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|