C28H25N5O4S2 — CID 137173291
2-[[4-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-3-nitrophenyl]methylideneamino]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 137173291) has the molecular formula C28H25N5O4S2 and a molecular weight of 559.67 g/mol. Its IUPAC name is 2-[[4-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-3-nitrophenyl]methylideneamino]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[4-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-3-nitrophenyl]methylideneamino]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 137173291 |
| Molecular Formula | C28H25N5O4S2 |
| Molecular Weight | 559.67 g/mol |
| Exact Mass | 559.13 |
| IUPAC Name | 2-[[4-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-3-nitrophenyl]methylideneamino]-N-(4-methylphenyl)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2c(N=Cc3ccc(Sc4nc(C)cc(=O)[nH]4)c([N+](=O)[O-])c3)sc3c2CCCC3)cc1 |
| InChI | InChI=1S/C28H25N5O4S2/c1-16-7-10-19(11-8-16)31-26(35)25-20-5-3-4-6-22(20)38-27(25)29-15-18-9-12-23(21(14-18)33(36)37)39-28-30-17(2)13-24(34)32-28/h7-15H,3-6H2,1-2H3,(H,31,35)(H,30,32,34) |
| InChIKey | YICZJYRODAMDBG-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 130.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.67 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|