C27H26BrN3O2S — CID 126018076
2-[[3-bromo-4-(cyanomethoxy)phenyl]methylideneamino]-N-(4-methylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide (PubChem CID 126018076) has the molecular formula C27H26BrN3O2S and a molecular weight of 536.50 g/mol. Its IUPAC name is 2-[[3-bromo-4-(cyanomethoxy)phenyl]methylideneamino]-N-(4-methylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide.
| Compound Name | 2-[[3-bromo-4-(cyanomethoxy)phenyl]methylideneamino]-N-(4-methylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 126018076 |
| Molecular Formula | C27H26BrN3O2S |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 535.09 |
| IUPAC Name | 2-[[3-bromo-4-(cyanomethoxy)phenyl]methylideneamino]-N-(4-methylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2c(N=Cc3ccc(OCC#N)c(Br)c3)sc3c2CCCCCC3)cc1 |
| InChI | InChI=1S/C27H26BrN3O2S/c1-18-8-11-20(12-9-18)31-26(32)25-21-6-4-2-3-5-7-24(21)34-27(25)30-17-19-10-13-23(22(28)16-19)33-15-14-29/h8-13,16-17H,2-7,15H2,1H3,(H,31,32) |
| InChIKey | FSWCSAGXTACHRR-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|