C28H31BrN2O3S — CID 126023201
2-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-N-(3,4-dimethylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide (PubChem CID 126023201) has the molecular formula C28H31BrN2O3S and a molecular weight of 555.54 g/mol. Its IUPAC name is 2-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-N-(3,4-dimethylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide.
| Compound Name | 2-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-N-(3,4-dimethylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 126023201 |
| Molecular Formula | C28H31BrN2O3S |
| Molecular Weight | 555.54 g/mol |
| Exact Mass | 554.12 |
| IUPAC Name | 2-[(5-bromo-2,4-dimethoxyphenyl)methylideneamino]-N-(3,4-dimethylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
| SMILES | COc1cc(OC)c(C=Nc2sc3c(c2C(=O)Nc2ccc(C)c(C)c2)CCCCCC3)cc1Br |
| InChI | InChI=1S/C28H31BrN2O3S/c1-17-11-12-20(13-18(17)2)31-27(32)26-21-9-7-5-6-8-10-25(21)35-28(26)30-16-19-14-22(29)24(34-4)15-23(19)33-3/h11-16H,5-10H2,1-4H3,(H,31,32) |
| InChIKey | QURRINJMSNTVMY-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.54 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|