C28H30N2OS — CID 126017772
N-(3,4-dimethylphenyl)-2-[[(E)-3-phenylprop-2-enylidene]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide (PubChem CID 126017772) has the molecular formula C28H30N2OS and a molecular weight of 442.63 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-2-[[(E)-3-phenylprop-2-enylidene]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-2-[[(E)-3-phenylprop-2-enylidene]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 126017772 |
| Molecular Formula | C28H30N2OS |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | N-(3,4-dimethylphenyl)-2-[[(E)-3-phenylprop-2-enylidene]amino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2c(N=C/C=C/c3ccccc3)sc3c2CCCCCC3)cc1C |
| InChI | InChI=1S/C28H30N2OS/c1-20-16-17-23(19-21(20)2)30-27(31)26-24-14-8-3-4-9-15-25(24)32-28(26)29-18-10-13-22-11-6-5-7-12-22/h5-7,10-13,16-19H,3-4,8-9,14-15H2,1-2H3,(H,30,31)/b13-10+,29-18? |
| InChIKey | FBYKPACWOFSBQP-XMMCFLJQSA-N |
| XLogP | 7.69 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|