C28H33N3OS — CID 4240037
N-cyclohexyl-2-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 4240037) has the molecular formula C28H33N3OS and a molecular weight of 459.66 g/mol. Its IUPAC name is N-cyclohexyl-2-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-cyclohexyl-2-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 4240037 |
| Molecular Formula | C28H33N3OS |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | N-cyclohexyl-2-[(2,5-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1cc(C=Nc2sc3c(c2C(=O)NC2CCCCC2)CCCC3)c(C)n1-c1ccccc1 |
| InChI | InChI=1S/C28H33N3OS/c1-19-17-21(20(2)31(19)23-13-7-4-8-14-23)18-29-28-26(24-15-9-10-16-25(24)33-28)27(32)30-22-11-5-3-6-12-22/h4,7-8,13-14,17-18,22H,3,5-6,9-12,15-16H2,1-2H3,(H,30,32) |
| InChIKey | NPPXSGFXNATRST-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|