C31H31Cl2N3OS — CID 21207134
N-cyclohexyl-2-[(E)-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 21207134) has the molecular formula C31H31Cl2N3OS and a molecular weight of 564.58 g/mol. Its IUPAC name is N-cyclohexyl-2-[(E)-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-cyclohexyl-2-[(E)-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 21207134 |
| Molecular Formula | C31H31Cl2N3OS |
| Molecular Weight | 564.58 g/mol |
| Exact Mass | 563.16 |
| IUPAC Name | N-cyclohexyl-2-[(E)-[1-[(3,4-dichlorophenyl)methyl]indol-3-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1c(/N=C/c2cn(Cc3ccc(Cl)c(Cl)c3)c3ccccc23)sc2c1CCCC2 |
| InChI | InChI=1S/C31H31Cl2N3OS/c32-25-15-14-20(16-26(25)33)18-36-19-21(23-10-4-6-12-27(23)36)17-34-31-29(24-11-5-7-13-28(24)38-31)30(37)35-22-8-2-1-3-9-22/h4,6,10,12,14-17,19,22H,1-3,5,7-9,11,13,18H2,(H,35,37)/b34-17+ |
| InChIKey | KDMFJWDOSAEUGI-KVAAJVFYSA-N |
| XLogP | 8.75 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.58 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|