C23H26N2O3S — CID 22829068
4-[(E)-[3-(cyclohexylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]iminomethyl]benzoic acid (PubChem CID 22829068) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is 4-[(E)-[3-(cyclohexylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]iminomethyl]benzoic acid.
| Compound Name | 4-[(E)-[3-(cyclohexylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]iminomethyl]benzoic acid |
|---|---|
| PubChem CID | 22829068 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 4-[(E)-[3-(cyclohexylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]iminomethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(/C=N/c2sc3c(c2C(=O)NC2CCCCC2)CCCC3)cc1 |
| InChI | InChI=1S/C23H26N2O3S/c26-21(25-17-6-2-1-3-7-17)20-18-8-4-5-9-19(18)29-22(20)24-14-15-10-12-16(13-11-15)23(27)28/h10-14,17H,1-9H2,(H,25,26)(H,27,28)/b24-14+ |
| InChIKey | VPTHCXJRSMEIHA-ZVHZXABRSA-N |
| XLogP | 5.14 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|