C31H37N3O3S — CID 126022784
methyl 3-[3-[[3-(cyclohexylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]-2-methylbenzoate (PubChem CID 126022784) has the molecular formula C31H37N3O3S and a molecular weight of 531.72 g/mol. Its IUPAC name is methyl 3-[3-[[3-(cyclohexylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]-2-methylbenzoate.
| Compound Name | methyl 3-[3-[[3-(cyclohexylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]-2-methylbenzoate |
|---|---|
| PubChem CID | 126022784 |
| Molecular Formula | C31H37N3O3S |
| Molecular Weight | 531.72 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | methyl 3-[3-[[3-(cyclohexylcarbamoyl)-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]iminomethyl]-2,5-dimethylpyrrol-1-yl]-2-methylbenzoate |
| SMILES | COC(=O)c1cccc(-n2c(C)cc(C=Nc3sc4c(c3C(=O)NC3CCCCC3)CCCC4)c2C)c1C |
| InChI | InChI=1S/C31H37N3O3S/c1-19-17-22(21(3)34(19)26-15-10-14-24(20(26)2)31(36)37-4)18-32-30-28(25-13-8-9-16-27(25)38-30)29(35)33-23-11-6-5-7-12-23/h10,14-15,17-18,23H,5-9,11-13,16H2,1-4H3,(H,33,35) |
| InChIKey | DVLMRINRLFTLFM-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 72.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.72 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|