C24H27N3O3 — CID 126198901
methyl 3-[3-[(Z)-2-cyano-3-(cyclopentylamino)-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]-2-methylbenzoate (PubChem CID 126198901) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is methyl 3-[3-[(Z)-2-cyano-3-(cyclopentylamino)-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]-2-methylbenzoate.
| Compound Name | methyl 3-[3-[(Z)-2-cyano-3-(cyclopentylamino)-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]-2-methylbenzoate |
|---|---|
| PubChem CID | 126198901 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | methyl 3-[3-[(Z)-2-cyano-3-(cyclopentylamino)-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]-2-methylbenzoate |
| SMILES | COC(=O)c1cccc(-n2c(C)cc(/C=C(/C#N)C(=O)NC3CCCC3)c2C)c1C |
| InChI | InChI=1S/C24H27N3O3/c1-15-12-18(13-19(14-25)23(28)26-20-8-5-6-9-20)17(3)27(15)22-11-7-10-21(16(22)2)24(29)30-4/h7,10-13,20H,5-6,8-9H2,1-4H3,(H,26,28)/b19-13- |
| InChIKey | DXXQPNJYTJLYNE-UYRXBGFRSA-N |
| XLogP | 4.15 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|