C21H22BrN3O — CID 126196589
(Z)-3-[1-(2-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-cyclopentylprop-2-enamide (PubChem CID 126196589) has the molecular formula C21H22BrN3O and a molecular weight of 412.33 g/mol. Its IUPAC name is (Z)-3-[1-(2-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-cyclopentylprop-2-enamide.
| Compound Name | (Z)-3-[1-(2-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-cyclopentylprop-2-enamide |
|---|---|
| PubChem CID | 126196589 |
| Molecular Formula | C21H22BrN3O |
| Molecular Weight | 412.33 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | (Z)-3-[1-(2-bromophenyl)-2,5-dimethylpyrrol-3-yl]-2-cyano-N-cyclopentylprop-2-enamide |
| SMILES | Cc1cc(/C=C(/C#N)C(=O)NC2CCCC2)c(C)n1-c1ccccc1Br |
| InChI | InChI=1S/C21H22BrN3O/c1-14-11-16(15(2)25(14)20-10-6-5-9-19(20)22)12-17(13-23)21(26)24-18-7-3-4-8-18/h5-6,9-12,18H,3-4,7-8H2,1-2H3,(H,24,26)/b17-12- |
| InChIKey | XLFLCEWZCMWRGC-ATVHPVEESA-N |
| XLogP | 4.82 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.33 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|