C19H23N5O — CID 9187527
(E)-2-cyano-N-cyclopropyl-3-[2,5-dimethyl-1-(2-propan-2-ylpyrazol-3-yl)pyrrol-3-yl]prop-2-enamide (PubChem CID 9187527) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is (E)-2-cyano-N-cyclopropyl-3-[2,5-dimethyl-1-(2-propan-2-ylpyrazol-3-yl)pyrrol-3-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-cyclopropyl-3-[2,5-dimethyl-1-(2-propan-2-ylpyrazol-3-yl)pyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 9187527 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (E)-2-cyano-N-cyclopropyl-3-[2,5-dimethyl-1-(2-propan-2-ylpyrazol-3-yl)pyrrol-3-yl]prop-2-enamide |
| SMILES | Cc1cc(/C=C(\C#N)C(=O)NC2CC2)c(C)n1-c1ccnn1C(C)C |
| InChI | InChI=1S/C19H23N5O/c1-12(2)24-18(7-8-21-24)23-13(3)9-15(14(23)4)10-16(11-20)19(25)22-17-5-6-17/h7-10,12,17H,5-6H2,1-4H3,(H,22,25)/b16-10+ |
| InChIKey | SMALROOIFJVJSU-MHWRWJLKSA-N |
| XLogP | 3.06 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|