C24H27N5O — CID 9187595
(E)-2-cyano-N-(2,3-dimethylphenyl)-3-[2,5-dimethyl-1-(2-propan-2-ylpyrazol-3-yl)pyrrol-3-yl]prop-2-enamide (PubChem CID 9187595) has the molecular formula C24H27N5O and a molecular weight of 401.51 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,3-dimethylphenyl)-3-[2,5-dimethyl-1-(2-propan-2-ylpyrazol-3-yl)pyrrol-3-yl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,3-dimethylphenyl)-3-[2,5-dimethyl-1-(2-propan-2-ylpyrazol-3-yl)pyrrol-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 9187595 |
| Molecular Formula | C24H27N5O |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.22 |
| IUPAC Name | (E)-2-cyano-N-(2,3-dimethylphenyl)-3-[2,5-dimethyl-1-(2-propan-2-ylpyrazol-3-yl)pyrrol-3-yl]prop-2-enamide |
| SMILES | Cc1cccc(NC(=O)/C(C#N)=C/c2cc(C)n(-c3ccnn3C(C)C)c2C)c1C |
| InChI | InChI=1S/C24H27N5O/c1-15(2)29-23(10-11-26-29)28-17(4)12-20(19(28)6)13-21(14-25)24(30)27-22-9-7-8-16(3)18(22)5/h7-13,15H,1-6H3,(H,27,30)/b21-13+ |
| InChIKey | JDFCUWHBNRSABF-FYJGNVAPSA-N |
| XLogP | 5.03 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|