C21H24N4O — CID 126242063
(Z)-2-cyano-N-cyclohexyl-3-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)prop-2-enamide (PubChem CID 126242063) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is (Z)-2-cyano-N-cyclohexyl-3-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-cyclohexyl-3-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 126242063 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (Z)-2-cyano-N-cyclohexyl-3-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)prop-2-enamide |
| SMILES | Cc1cc(/C=C(/C#N)C(=O)NC2CCCCC2)c(C)n1-c1ccccn1 |
| InChI | InChI=1S/C21H24N4O/c1-15-12-17(16(2)25(15)20-10-6-7-11-23-20)13-18(14-22)21(26)24-19-8-4-3-5-9-19/h6-7,10-13,19H,3-5,8-9H2,1-2H3,(H,24,26)/b18-13- |
| InChIKey | CYDFWNJMQGNQJK-AQTBWJFISA-N |
| XLogP | 3.85 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|