C23H22N4O2 — CID 126238203
(Z)-2-cyano-3-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-N-(4-ethoxyphenyl)prop-2-enamide (PubChem CID 126238203) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-N-(4-ethoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-N-(4-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126238203 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (Z)-2-cyano-3-(2,5-dimethyl-1-pyridin-2-ylpyrrol-3-yl)-N-(4-ethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(NC(=O)/C(C#N)=C\c2cc(C)n(-c3ccccn3)c2C)cc1 |
| InChI | InChI=1S/C23H22N4O2/c1-4-29-21-10-8-20(9-11-21)26-23(28)19(15-24)14-18-13-16(2)27(17(18)3)22-7-5-6-12-25-22/h5-14H,4H2,1-3H3,(H,26,28)/b19-14- |
| InChIKey | MPZWBECPZFWSMY-RGEXLXHISA-N |
| XLogP | 4.43 |
| TPSA | 79.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|