C21H26N4O2 — CID 9186878
(E)-2-cyano-3-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]-N-[(1R,2R)-2-methylcyclohexyl]prop-2-enamide (PubChem CID 9186878) has the molecular formula C21H26N4O2 and a molecular weight of 366.47 g/mol. Its IUPAC name is (E)-2-cyano-3-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]-N-[(1R,2R)-2-methylcyclohexyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]-N-[(1R,2R)-2-methylcyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 9186878 |
| Molecular Formula | C21H26N4O2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | (E)-2-cyano-3-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]-N-[(1R,2R)-2-methylcyclohexyl]prop-2-enamide |
| SMILES | Cc1cc(-n2c(C)cc(/C=C(\C#N)C(=O)N[C@@H]3CCCC[C@H]3C)c2C)no1 |
| InChI | InChI=1S/C21H26N4O2/c1-13-7-5-6-8-19(13)23-21(26)18(12-22)11-17-9-14(2)25(16(17)4)20-10-15(3)27-24-20/h9-11,13,19H,5-8H2,1-4H3,(H,23,26)/b18-11+/t13-,19-/m1/s1 |
| InChIKey | SNZFCJYRLTZFCT-RNRVPZRVSA-N |
| XLogP | 3.99 |
| TPSA | 83.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|