C17H17N3O3 — CID 9211150
prop-2-enyl (E)-2-cyano-3-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]prop-2-enoate (PubChem CID 9211150) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is prop-2-enyl (E)-2-cyano-3-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]prop-2-enoate.
| Compound Name | prop-2-enyl (E)-2-cyano-3-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 9211150 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | prop-2-enyl (E)-2-cyano-3-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]prop-2-enoate |
| SMILES | C=CCOC(=O)/C(C#N)=C/c1cc(C)n(-c2cc(C)on2)c1C |
| InChI | InChI=1S/C17H17N3O3/c1-5-6-22-17(21)15(10-18)9-14-7-11(2)20(13(14)4)16-8-12(3)23-19-16/h5,7-9H,1,6H2,2-4H3/b15-9+ |
| InChIKey | ZBAJCXGGGREFBS-OQLLNIDSSA-N |
| XLogP | 3.03 |
| TPSA | 81.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|