C25H21N3O5 — CID 21381787
methyl 3-[3-[(Z)-2-cyano-3-(3-nitrophenyl)-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]-2-methylbenzoate (PubChem CID 21381787) has the molecular formula C25H21N3O5 and a molecular weight of 443.46 g/mol. Its IUPAC name is methyl 3-[3-[(Z)-2-cyano-3-(3-nitrophenyl)-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]-2-methylbenzoate.
| Compound Name | methyl 3-[3-[(Z)-2-cyano-3-(3-nitrophenyl)-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]-2-methylbenzoate |
|---|---|
| PubChem CID | 21381787 |
| Molecular Formula | C25H21N3O5 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | methyl 3-[3-[(Z)-2-cyano-3-(3-nitrophenyl)-3-oxoprop-1-enyl]-2,5-dimethylpyrrol-1-yl]-2-methylbenzoate |
| SMILES | COC(=O)c1cccc(-n2c(C)cc(/C=C(/C#N)C(=O)c3cccc([N+](=O)[O-])c3)c2C)c1C |
| InChI | InChI=1S/C25H21N3O5/c1-15-11-19(12-20(14-26)24(29)18-7-5-8-21(13-18)28(31)32)17(3)27(15)23-10-6-9-22(16(23)2)25(30)33-4/h5-13H,1-4H3/b20-12- |
| InChIKey | KXXCOIOXEQFSMS-NDENLUEZSA-N |
| XLogP | 4.89 |
| TPSA | 115.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|