C23H21IN2O3S — CID 137162369
2-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 137162369) has the molecular formula C23H21IN2O3S and a molecular weight of 532.40 g/mol. Its IUPAC name is 2-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 137162369 |
| Molecular Formula | C23H21IN2O3S |
| Molecular Weight | 532.40 g/mol |
| Exact Mass | 532.03 |
| IUPAC Name | 2-[(4-hydroxy-3-iodo-5-methoxyphenyl)methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | COc1cc(C=Nc2sc3c(c2C(=O)Nc2ccccc2)CCCC3)cc(I)c1O |
| InChI | InChI=1S/C23H21IN2O3S/c1-29-18-12-14(11-17(24)21(18)27)13-25-23-20(16-9-5-6-10-19(16)30-23)22(28)26-15-7-3-2-4-8-15/h2-4,7-8,11-13,27H,5-6,9-10H2,1H3,(H,26,28) |
| InChIKey | SHUYFSVQWXRJHA-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.40 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|