C29H32IN3O4S — CID 126023214
2-[[4-(2-amino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-N-(2-methylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide (PubChem CID 126023214) has the molecular formula C29H32IN3O4S and a molecular weight of 645.56 g/mol. Its IUPAC name is 2-[[4-(2-amino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-N-(2-methylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide.
| Compound Name | 2-[[4-(2-amino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-N-(2-methylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 126023214 |
| Molecular Formula | C29H32IN3O4S |
| Molecular Weight | 645.56 g/mol |
| Exact Mass | 645.12 |
| IUPAC Name | 2-[[4-(2-amino-2-oxoethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-N-(2-methylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
| SMILES | CCOc1cc(C=Nc2sc3c(c2C(=O)Nc2ccccc2C)CCCCCC3)cc(I)c1OCC(N)=O |
| InChI | InChI=1S/C29H32IN3O4S/c1-3-36-23-15-19(14-21(30)27(23)37-17-25(31)34)16-32-29-26(20-11-6-4-5-7-13-24(20)38-29)28(35)33-22-12-9-8-10-18(22)2/h8-10,12,14-16H,3-7,11,13,17H2,1-2H3,(H2,31,34)(H,33,35) |
| InChIKey | QXDJGQWBWJREJV-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.56 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|