C35H36N2O5S — CID 126016811
2-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxyphenyl]methylideneamino]-N-(2-methylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide (PubChem CID 126016811) has the molecular formula C35H36N2O5S and a molecular weight of 596.75 g/mol. Its IUPAC name is 2-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxyphenyl]methylideneamino]-N-(2-methylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide.
| Compound Name | 2-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxyphenyl]methylideneamino]-N-(2-methylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 126016811 |
| Molecular Formula | C35H36N2O5S |
| Molecular Weight | 596.75 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | 2-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxyphenyl]methylideneamino]-N-(2-methylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
| SMILES | CCOc1cc(C=Nc2sc3c(c2C(=O)Nc2ccccc2C)CCCCCC3)ccc1OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C35H36N2O5S/c1-3-39-30-18-24(14-16-28(30)40-21-25-15-17-29-31(19-25)42-22-41-29)20-36-35-33(26-11-6-4-5-7-13-32(26)43-35)34(38)37-27-12-9-8-10-23(27)2/h8-10,12,14-20H,3-7,11,13,21-22H2,1-2H3,(H,37,38) |
| InChIKey | BIQZFDJCNSTZKD-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.75 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|