C25H25IN2O3S — CID 135589092
N-benzyl-2-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 135589092) has the molecular formula C25H25IN2O3S and a molecular weight of 560.46 g/mol. Its IUPAC name is N-benzyl-2-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-benzyl-2-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 135589092 |
| Molecular Formula | C25H25IN2O3S |
| Molecular Weight | 560.46 g/mol |
| Exact Mass | 560.06 |
| IUPAC Name | N-benzyl-2-[(Z)-(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCOc1cc(/C=N\c2sc3c(c2C(=O)NCc2ccccc2)CCCC3)cc(I)c1O |
| InChI | InChI=1S/C25H25IN2O3S/c1-2-31-20-13-17(12-19(26)23(20)29)15-28-25-22(18-10-6-7-11-21(18)32-25)24(30)27-14-16-8-4-3-5-9-16/h3-5,8-9,12-13,15,29H,2,6-7,10-11,14H2,1H3,(H,27,30)/b28-15- |
| InChIKey | KVFGDEPNHDNWHM-MBTHVWNTSA-N |
| XLogP | 6.02 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.46 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|