C28H31IN2O3S — CID 137085612
(6S)-6-tert-butyl-2-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 137085612) has the molecular formula C28H31IN2O3S and a molecular weight of 602.54 g/mol. Its IUPAC name is (6S)-6-tert-butyl-2-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-6-tert-butyl-2-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 137085612 |
| Molecular Formula | C28H31IN2O3S |
| Molecular Weight | 602.54 g/mol |
| Exact Mass | 602.11 |
| IUPAC Name | (6S)-6-tert-butyl-2-[(3-ethoxy-4-hydroxy-5-iodophenyl)methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCOc1cc(C=Nc2sc3c(c2C(=O)Nc2ccccc2)CC[C@H](C(C)(C)C)C3)cc(I)c1O |
| InChI | InChI=1S/C28H31IN2O3S/c1-5-34-22-14-17(13-21(29)25(22)32)16-30-27-24(26(33)31-19-9-7-6-8-10-19)20-12-11-18(28(2,3)4)15-23(20)35-27/h6-10,13-14,16,18,32H,5,11-12,15H2,1-4H3,(H,31,33)/t18-/m0/s1 |
| InChIKey | PDOXBLMSVSUTLA-SFHVURJKSA-N |
| XLogP | 7.61 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.54 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|