C33H30Cl2I2N2O2S — CID 126092111
(6R)-6-tert-butyl-2-[[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126092111) has the molecular formula C33H30Cl2I2N2O2S and a molecular weight of 843.40 g/mol. Its IUPAC name is (6R)-6-tert-butyl-2-[[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6R)-6-tert-butyl-2-[[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126092111 |
| Molecular Formula | C33H30Cl2I2N2O2S |
| Molecular Weight | 843.40 g/mol |
| Exact Mass | 841.95 |
| IUPAC Name | (6R)-6-tert-butyl-2-[[4-[(2,4-dichlorophenyl)methoxy]-3,5-diiodophenyl]methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CC(C)(C)[C@@H]1CCc2c(sc(N=Cc3cc(I)c(OCc4ccc(Cl)cc4Cl)c(I)c3)c2C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C33H30Cl2I2N2O2S/c1-33(2,3)21-10-12-24-28(15-21)42-32(29(24)31(40)39-23-7-5-4-6-8-23)38-17-19-13-26(36)30(27(37)14-19)41-18-20-9-11-22(34)16-25(20)35/h4-9,11,13-14,16-17,21H,10,12,15,18H2,1-3H3,(H,39,40)/t21-/m1/s1 |
| InChIKey | ZYGNNQZHYOEIDU-OAQYLSRUSA-N |
| XLogP | 11.00 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.40 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|