C29H30I2N2O2S — CID 126095966
(6S)-6-tert-butyl-2-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126095966) has the molecular formula C29H30I2N2O2S and a molecular weight of 724.45 g/mol. Its IUPAC name is (6S)-6-tert-butyl-2-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-6-tert-butyl-2-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126095966 |
| Molecular Formula | C29H30I2N2O2S |
| Molecular Weight | 724.45 g/mol |
| Exact Mass | 724.01 |
| IUPAC Name | (6S)-6-tert-butyl-2-[(3,5-diiodo-4-prop-2-enoxyphenyl)methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | C=CCOc1c(I)cc(C=Nc2sc3c(c2C(=O)Nc2ccccc2)CC[C@H](C(C)(C)C)C3)cc1I |
| InChI | InChI=1S/C29H30I2N2O2S/c1-5-13-35-26-22(30)14-18(15-23(26)31)17-32-28-25(27(34)33-20-9-7-6-8-10-20)21-12-11-19(29(2,3)4)16-24(21)36-28/h5-10,14-15,17,19H,1,11-13,16H2,2-4H3,(H,33,34)/t19-/m0/s1 |
| InChIKey | NGONTJSSIFJQTF-IBGZPJMESA-N |
| XLogP | 8.68 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.45 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|