C21H20N2OS2 — CID 6323641
N-benzyl-2-[(E)-thiophen-2-ylmethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 6323641) has the molecular formula C21H20N2OS2 and a molecular weight of 380.54 g/mol. Its IUPAC name is N-benzyl-2-[(E)-thiophen-2-ylmethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-benzyl-2-[(E)-thiophen-2-ylmethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 6323641 |
| Molecular Formula | C21H20N2OS2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | N-benzyl-2-[(E)-thiophen-2-ylmethylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1c(/N=C/c2cccs2)sc2c1CCCC2 |
| InChI | InChI=1S/C21H20N2OS2/c24-20(22-13-15-7-2-1-3-8-15)19-17-10-4-5-11-18(17)26-21(19)23-14-16-9-6-12-25-16/h1-3,6-9,12,14H,4-5,10-11,13H2,(H,22,24)/b23-14+ |
| InChIKey | UYZDDWHZKHALQO-OEAKJJBVSA-N |
| XLogP | 5.37 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|