C23H27N3O3S — CID 174006933
2-[N'-[3-(benzylcarbamoyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl]carbamimidoyl]cyclohexane-1-carboxylic acid (PubChem CID 174006933) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is 2-[N'-[3-(benzylcarbamoyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl]carbamimidoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[N'-[3-(benzylcarbamoyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl]carbamimidoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 174006933 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 2-[N'-[3-(benzylcarbamoyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl]carbamimidoyl]cyclohexane-1-carboxylic acid |
| SMILES | NC(=Nc1sc2c(c1C(=O)NCc1ccccc1)CCC2)C1CCCCC1C(=O)O |
| InChI | InChI=1S/C23H27N3O3S/c24-20(15-9-4-5-10-16(15)23(28)29)26-22-19(17-11-6-12-18(17)30-22)21(27)25-13-14-7-2-1-3-8-14/h1-3,7-8,15-16H,4-6,9-13H2,(H2,24,26)(H,25,27)(H,28,29) |
| InChIKey | UFEYSXRNKBBPRR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|