C28H25N3O4S — CID 21207212
N-benzyl-2-[(Z)-[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 21207212) has the molecular formula C28H25N3O4S and a molecular weight of 499.59 g/mol. Its IUPAC name is N-benzyl-2-[(Z)-[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-benzyl-2-[(Z)-[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 21207212 |
| Molecular Formula | C28H25N3O4S |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | N-benzyl-2-[(Z)-[5-(2-methyl-5-nitrophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1-c1ccc(/C=N\c2sc3c(c2C(=O)NCc2ccccc2)CCCC3)o1 |
| InChI | InChI=1S/C28H25N3O4S/c1-18-11-12-20(31(33)34)15-23(18)24-14-13-21(35-24)17-30-28-26(22-9-5-6-10-25(22)36-28)27(32)29-16-19-7-3-2-4-8-19/h2-4,7-8,11-15,17H,5-6,9-10,16H2,1H3,(H,29,32)/b30-17- |
| InChIKey | LXUJNFLETNGHNJ-LQNQUEJISA-N |
| XLogP | 6.78 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|