C26H27N3O3S — CID 126017145
N-(2,3-dimethylphenyl)-2-[(4-nitrophenyl)methylideneamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide (PubChem CID 126017145) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[(4-nitrophenyl)methylideneamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[(4-nitrophenyl)methylideneamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 126017145 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[(4-nitrophenyl)methylideneamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2c(N=Cc3ccc([N+](=O)[O-])cc3)sc3c2CCCCCC3)c1C |
| InChI | InChI=1S/C26H27N3O3S/c1-17-8-7-10-22(18(17)2)28-25(30)24-21-9-5-3-4-6-11-23(21)33-26(24)27-16-19-12-14-20(15-13-19)29(31)32/h7-8,10,12-16H,3-6,9,11H2,1-2H3,(H,28,30) |
| InChIKey | BWBLYJHMSGKTKE-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 84.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|