C24H25BrN2O2S — CID 23903834
2-[(5-bromofuran-2-yl)methylideneamino]-N-(2,3-dimethylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide (PubChem CID 23903834) has the molecular formula C24H25BrN2O2S and a molecular weight of 485.45 g/mol. Its IUPAC name is 2-[(5-bromofuran-2-yl)methylideneamino]-N-(2,3-dimethylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide.
| Compound Name | 2-[(5-bromofuran-2-yl)methylideneamino]-N-(2,3-dimethylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 23903834 |
| Molecular Formula | C24H25BrN2O2S |
| Molecular Weight | 485.45 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | 2-[(5-bromofuran-2-yl)methylideneamino]-N-(2,3-dimethylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
| SMILES | Cc1cccc(NC(=O)c2c(N=Cc3ccc(Br)o3)sc3c2CCCCCC3)c1C |
| InChI | InChI=1S/C24H25BrN2O2S/c1-15-8-7-10-19(16(15)2)27-23(28)22-18-9-5-3-4-6-11-20(18)30-24(22)26-14-17-12-13-21(25)29-17/h7-8,10,12-14H,3-6,9,11H2,1-2H3,(H,27,28) |
| InChIKey | UGQNOBFGSZIXFM-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.45 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|