C32H32N2O4S — CID 126021150
methyl 4-[5-[[3-[(2,3-dimethylphenyl)carbamoyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl]iminomethyl]furan-2-yl]benzoate (PubChem CID 126021150) has the molecular formula C32H32N2O4S and a molecular weight of 540.69 g/mol. Its IUPAC name is methyl 4-[5-[[3-[(2,3-dimethylphenyl)carbamoyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl]iminomethyl]furan-2-yl]benzoate.
| Compound Name | methyl 4-[5-[[3-[(2,3-dimethylphenyl)carbamoyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl]iminomethyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126021150 |
| Molecular Formula | C32H32N2O4S |
| Molecular Weight | 540.69 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | methyl 4-[5-[[3-[(2,3-dimethylphenyl)carbamoyl]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophen-2-yl]iminomethyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(C=Nc3sc4c(c3C(=O)Nc3cccc(C)c3C)CCCCCC4)o2)cc1 |
| InChI | InChI=1S/C32H32N2O4S/c1-20-9-8-11-26(21(20)2)34-30(35)29-25-10-6-4-5-7-12-28(25)39-31(29)33-19-24-17-18-27(38-24)22-13-15-23(16-14-22)32(36)37-3/h8-9,11,13-19H,4-7,10,12H2,1-3H3,(H,34,35) |
| InChIKey | NAFNVJKBBXTWDF-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.69 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|