C27H29N3O4S — CID 4141684
N-cyclohexyl-2-[[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 4141684) has the molecular formula C27H29N3O4S and a molecular weight of 491.61 g/mol. Its IUPAC name is N-cyclohexyl-2-[[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-cyclohexyl-2-[[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 4141684 |
| Molecular Formula | C27H29N3O4S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | N-cyclohexyl-2-[[5-(2-methyl-4-nitrophenyl)furan-2-yl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1-c1ccc(C=Nc2sc3c(c2C(=O)NC2CCCCC2)CCCC3)o1 |
| InChI | InChI=1S/C27H29N3O4S/c1-17-15-19(30(32)33)11-13-21(17)23-14-12-20(34-23)16-28-27-25(22-9-5-6-10-24(22)35-27)26(31)29-18-7-3-2-4-8-18/h11-16,18H,2-10H2,1H3,(H,29,31) |
| InChIKey | RUKZMHOAIZVINR-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|