C36H40N2O3S — CID 126020769
N-(2,3-dimethylphenyl)-2-[[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide (PubChem CID 126020769) has the molecular formula C36H40N2O3S and a molecular weight of 580.79 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 126020769 |
| Molecular Formula | C36H40N2O3S |
| Molecular Weight | 580.79 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[[3-ethoxy-4-[(3-methylphenyl)methoxy]phenyl]methylideneamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
| SMILES | CCOc1cc(C=Nc2sc3c(c2C(=O)Nc2cccc(C)c2C)CCCCCC3)ccc1OCc1cccc(C)c1 |
| InChI | InChI=1S/C36H40N2O3S/c1-5-40-32-21-27(18-19-31(32)41-23-28-14-10-12-24(2)20-28)22-37-36-34(29-15-8-6-7-9-17-33(29)42-36)35(39)38-30-16-11-13-25(3)26(30)4/h10-14,16,18-22H,5-9,15,17,23H2,1-4H3,(H,38,39) |
| InChIKey | MKRNEXFSUAODRS-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.79 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|