C35H35ClN2O3S — CID 126002647
N-benzyl-2-[[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126002647) has the molecular formula C35H35ClN2O3S and a molecular weight of 599.20 g/mol. Its IUPAC name is N-benzyl-2-[[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-benzyl-2-[[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126002647 |
| Molecular Formula | C35H35ClN2O3S |
| Molecular Weight | 599.20 g/mol |
| Exact Mass | 598.21 |
| IUPAC Name | N-benzyl-2-[[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | C=CCc1cc(C=Nc2sc3c(c2C(=O)NCc2ccccc2)CCCC3)cc(OCC)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C35H35ClN2O3S/c1-3-10-27-19-26(20-30(40-4-2)33(27)41-23-25-15-17-28(36)18-16-25)22-38-35-32(29-13-8-9-14-31(29)42-35)34(39)37-21-24-11-6-5-7-12-24/h3,5-7,11-12,15-20,22H,1,4,8-10,13-14,21,23H2,2H3,(H,37,39) |
| InChIKey | COJJRKZHEQDIIQ-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.20 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|