C24H23ClN2O2S — CID 137051448
2-[(5-chloro-2-hydroxyphenyl)methylideneamino]-N-phenyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide (PubChem CID 137051448) has the molecular formula C24H23ClN2O2S and a molecular weight of 438.98 g/mol. Its IUPAC name is 2-[(5-chloro-2-hydroxyphenyl)methylideneamino]-N-phenyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide.
| Compound Name | 2-[(5-chloro-2-hydroxyphenyl)methylideneamino]-N-phenyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 137051448 |
| Molecular Formula | C24H23ClN2O2S |
| Molecular Weight | 438.98 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 2-[(5-chloro-2-hydroxyphenyl)methylideneamino]-N-phenyl-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1c(N=Cc2cc(Cl)ccc2O)sc2c1CCCCCC2 |
| InChI | InChI=1S/C24H23ClN2O2S/c25-17-12-13-20(28)16(14-17)15-26-24-22(23(29)27-18-8-4-3-5-9-18)19-10-6-1-2-7-11-21(19)30-24/h3-5,8-9,12-15,28H,1-2,6-7,10-11H2,(H,27,29) |
| InChIKey | SYQYWXICAVABEW-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.98 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|