C28H27BrN2O2S — CID 126019532
2-[(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-N-(3-methylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide (PubChem CID 126019532) has the molecular formula C28H27BrN2O2S and a molecular weight of 535.51 g/mol. Its IUPAC name is 2-[(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-N-(3-methylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide.
| Compound Name | 2-[(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-N-(3-methylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 126019532 |
| Molecular Formula | C28H27BrN2O2S |
| Molecular Weight | 535.51 g/mol |
| Exact Mass | 534.10 |
| IUPAC Name | 2-[(5-bromo-2-prop-2-ynoxyphenyl)methylideneamino]-N-(3-methylphenyl)-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxamide |
| SMILES | C#CCOc1ccc(Br)cc1C=Nc1sc2c(c1C(=O)Nc1cccc(C)c1)CCCCCC2 |
| InChI | InChI=1S/C28H27BrN2O2S/c1-3-15-33-24-14-13-21(29)17-20(24)18-30-28-26(23-11-6-4-5-7-12-25(23)34-28)27(32)31-22-10-8-9-19(2)16-22/h1,8-10,13-14,16-18H,4-7,11-12,15H2,2H3,(H,31,32) |
| InChIKey | JIWACIZWSKICBF-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.51 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|