C29H30N2O2S — CID 126084977
(6R)-6-tert-butyl-N-phenyl-2-[(2-prop-2-ynoxyphenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126084977) has the molecular formula C29H30N2O2S and a molecular weight of 470.64 g/mol. Its IUPAC name is (6R)-6-tert-butyl-N-phenyl-2-[(2-prop-2-ynoxyphenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6R)-6-tert-butyl-N-phenyl-2-[(2-prop-2-ynoxyphenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126084977 |
| Molecular Formula | C29H30N2O2S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | (6R)-6-tert-butyl-N-phenyl-2-[(2-prop-2-ynoxyphenyl)methylideneamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | C#CCOc1ccccc1C=Nc1sc2c(c1C(=O)Nc1ccccc1)CC[C@@H](C(C)(C)C)C2 |
| InChI | InChI=1S/C29H30N2O2S/c1-5-17-33-24-14-10-9-11-20(24)19-30-28-26(27(32)31-22-12-7-6-8-13-22)23-16-15-21(29(2,3)4)18-25(23)34-28/h1,6-14,19,21H,15-18H2,2-4H3,(H,31,32)/t21-/m1/s1 |
| InChIKey | IZPWNPHKMAPFJT-OAQYLSRUSA-N |
| XLogP | 6.91 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|