C27H23N5O4S2 — CID 135628208
2-[(E)-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-5-nitrophenyl]methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 135628208) has the molecular formula C27H23N5O4S2 and a molecular weight of 545.65 g/mol. Its IUPAC name is 2-[(E)-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-5-nitrophenyl]methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[(E)-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-5-nitrophenyl]methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 135628208 |
| Molecular Formula | C27H23N5O4S2 |
| Molecular Weight | 545.65 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | 2-[(E)-[2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-5-nitrophenyl]methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1cc(=O)[nH]c(Sc2ccc([N+](=O)[O-])cc2/C=N/c2sc3c(c2C(=O)Nc2ccccc2)CCCC3)n1 |
| InChI | InChI=1S/C27H23N5O4S2/c1-16-13-23(33)31-27(29-16)38-21-12-11-19(32(35)36)14-17(21)15-28-26-24(20-9-5-6-10-22(20)37-26)25(34)30-18-7-3-2-4-8-18/h2-4,7-8,11-15H,5-6,9-10H2,1H3,(H,30,34)(H,29,31,33)/b28-15+ |
| InChIKey | FBCVJIYLEUKYTE-RWPZCVJISA-N |
| XLogP | 6.08 |
| TPSA | 130.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.65 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|