C34H34N6O4S2 — CID 126200783
(6S)-6-tert-butyl-2-[[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitrophenyl]methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 126200783) has the molecular formula C34H34N6O4S2 and a molecular weight of 654.82 g/mol. Its IUPAC name is (6S)-6-tert-butyl-2-[[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitrophenyl]methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | (6S)-6-tert-butyl-2-[[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitrophenyl]methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 126200783 |
| Molecular Formula | C34H34N6O4S2 |
| Molecular Weight | 654.82 g/mol |
| Exact Mass | 654.21 |
| IUPAC Name | (6S)-6-tert-butyl-2-[[2-[[4-ethyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-5-nitrophenyl]methylideneamino]-N-phenyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCn1c(Sc2ccc([N+](=O)[O-])cc2C=Nc2sc3c(c2C(=O)Nc2ccccc2)CC[C@H](C(C)(C)C)C3)nnc1-c1ccco1 |
| InChI | InChI=1S/C34H34N6O4S2/c1-5-39-30(26-12-9-17-44-26)37-38-33(39)46-27-16-14-24(40(42)43)18-21(27)20-35-32-29(31(41)36-23-10-7-6-8-11-23)25-15-13-22(34(2,3)4)19-28(25)45-32/h6-12,14,16-18,20,22H,5,13,15,19H2,1-4H3,(H,36,41)/t22-/m0/s1 |
| InChIKey | MZNUAYHVICDAPJ-QFIPXVFZSA-N |
| XLogP | 8.83 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.82 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|